rename Proc to Process
This commit is contained in:
parent
791b68aaa7
commit
71f9a49704
@ -13,7 +13,7 @@ pub mod uart;
|
|||||||
|
|
||||||
use crate::{
|
use crate::{
|
||||||
fs::file::{devsw, CONSOLE},
|
fs::file::{devsw, CONSOLE},
|
||||||
proc::proc::{procdump, wakeup, Proc},
|
proc::process::{procdump, wakeup, Process},
|
||||||
sync::mutex::Mutex,
|
sync::mutex::Mutex,
|
||||||
};
|
};
|
||||||
use core::{ffi::c_void, ptr::addr_of_mut};
|
use core::{ffi::c_void, ptr::addr_of_mut};
|
||||||
@ -114,7 +114,7 @@ pub fn consoleread(user_dst: i32, mut dst: u64, mut n: i32) -> i32 {
|
|||||||
// Wait until interrupt handler has put
|
// Wait until interrupt handler has put
|
||||||
// some input into cons.buffer.
|
// some input into cons.buffer.
|
||||||
while console.read_index == console.write_index {
|
while console.read_index == console.write_index {
|
||||||
if Proc::current().unwrap().is_killed() {
|
if Process::current().unwrap().is_killed() {
|
||||||
// cons.lock.unlock();
|
// cons.lock.unlock();
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
|
@ -2,7 +2,7 @@
|
|||||||
#![allow(non_upper_case_globals)]
|
#![allow(non_upper_case_globals)]
|
||||||
|
|
||||||
use crate::{
|
use crate::{
|
||||||
console::consoleintr, proc::proc::wakeup, queue::Queue, sync::mutex::Mutex,
|
console::consoleintr, proc::process::wakeup, queue::Queue, sync::mutex::Mutex,
|
||||||
trap::InterruptBlocker,
|
trap::InterruptBlocker,
|
||||||
};
|
};
|
||||||
use core::ptr::addr_of;
|
use core::ptr::addr_of;
|
||||||
|
@ -4,7 +4,7 @@ use crate::{
|
|||||||
fs::{log, stat::Stat},
|
fs::{log, stat::Stat},
|
||||||
io::pipe::Pipe,
|
io::pipe::Pipe,
|
||||||
mem::virtual_memory::copyout,
|
mem::virtual_memory::copyout,
|
||||||
proc::proc::Proc,
|
proc::process::Process,
|
||||||
sync::{sleeplock::Sleeplock, spinlock::Spinlock},
|
sync::{sleeplock::Sleeplock, spinlock::Spinlock},
|
||||||
};
|
};
|
||||||
use core::ptr::{addr_of_mut, null_mut};
|
use core::ptr::{addr_of_mut, null_mut};
|
||||||
@ -206,7 +206,7 @@ pub unsafe extern "C" fn fileclose(file: *mut File) {
|
|||||||
/// `addr` is a user virtual address, pointing to a Stat.
|
/// `addr` is a user virtual address, pointing to a Stat.
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn filestat(file: *mut File, addr: u64) -> i32 {
|
pub unsafe extern "C" fn filestat(file: *mut File, addr: u64) -> i32 {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
let mut stat = Stat::default();
|
let mut stat = Stat::default();
|
||||||
|
|
||||||
if (*file).kind == FileType::Inode || (*file).kind == FileType::Device {
|
if (*file).kind == FileType::Inode || (*file).kind == FileType::Device {
|
||||||
|
@ -4,7 +4,7 @@ use crate::{
|
|||||||
kalloc::{kalloc, kfree},
|
kalloc::{kalloc, kfree},
|
||||||
virtual_memory::{copyin, copyout},
|
virtual_memory::{copyin, copyout},
|
||||||
},
|
},
|
||||||
proc::proc::{wakeup, Proc},
|
proc::process::{wakeup, Process},
|
||||||
sync::spinlock::Spinlock,
|
sync::spinlock::Spinlock,
|
||||||
};
|
};
|
||||||
use core::ptr::{addr_of, addr_of_mut};
|
use core::ptr::{addr_of, addr_of_mut};
|
||||||
@ -88,7 +88,7 @@ impl Pipe {
|
|||||||
}
|
}
|
||||||
pub unsafe fn write(&self, addr: u64, num_bytes: usize) -> Result<usize> {
|
pub unsafe fn write(&self, addr: u64, num_bytes: usize) -> Result<usize> {
|
||||||
let mut i = 0;
|
let mut i = 0;
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
let guard = self.lock.lock();
|
let guard = self.lock.lock();
|
||||||
|
|
||||||
while i < num_bytes {
|
while i < num_bytes {
|
||||||
@ -116,7 +116,7 @@ impl Pipe {
|
|||||||
#[allow(clippy::while_immutable_condition)]
|
#[allow(clippy::while_immutable_condition)]
|
||||||
pub unsafe fn read(&self, addr: u64, num_bytes: usize) -> Result<usize> {
|
pub unsafe fn read(&self, addr: u64, num_bytes: usize) -> Result<usize> {
|
||||||
let mut i = 0;
|
let mut i = 0;
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
let guard = self.lock.lock();
|
let guard = self.lock.lock();
|
||||||
|
|
||||||
// DOC: pipe-empty
|
// DOC: pipe-empty
|
||||||
|
@ -63,7 +63,7 @@ pub unsafe fn main() -> ! {
|
|||||||
println!("\nxv6 kernel is booting");
|
println!("\nxv6 kernel is booting");
|
||||||
mem::virtual_memory::kvminit();
|
mem::virtual_memory::kvminit();
|
||||||
mem::virtual_memory::kvminithart();
|
mem::virtual_memory::kvminithart();
|
||||||
proc::proc::procinit();
|
proc::process::procinit();
|
||||||
trap::trapinithart();
|
trap::trapinithart();
|
||||||
arch::riscv::plic::plicinit();
|
arch::riscv::plic::plicinit();
|
||||||
arch::riscv::plic::plicinithart();
|
arch::riscv::plic::plicinithart();
|
||||||
@ -71,7 +71,7 @@ pub unsafe fn main() -> ! {
|
|||||||
fs::iinit();
|
fs::iinit();
|
||||||
fs::file::fileinit();
|
fs::file::fileinit();
|
||||||
fs::virtio_disk::virtio_disk_init();
|
fs::virtio_disk::virtio_disk_init();
|
||||||
proc::proc::userinit();
|
proc::process::userinit();
|
||||||
STARTED = true;
|
STARTED = true;
|
||||||
} else {
|
} else {
|
||||||
while !STARTED {
|
while !STARTED {
|
||||||
@ -82,7 +82,7 @@ pub unsafe fn main() -> ! {
|
|||||||
arch::riscv::plic::plicinithart();
|
arch::riscv::plic::plicinithart();
|
||||||
}
|
}
|
||||||
|
|
||||||
proc::proc::scheduler();
|
proc::process::scheduler();
|
||||||
}
|
}
|
||||||
|
|
||||||
#[panic_handler]
|
#[panic_handler]
|
||||||
|
@ -7,7 +7,7 @@ use crate::{
|
|||||||
kalloc::{kalloc, kfree},
|
kalloc::{kalloc, kfree},
|
||||||
memmove, memset,
|
memmove, memset,
|
||||||
},
|
},
|
||||||
proc::proc::proc_mapstacks,
|
proc::process::proc_mapstacks,
|
||||||
};
|
};
|
||||||
use core::ptr::{addr_of, addr_of_mut, null_mut};
|
use core::ptr::{addr_of, addr_of_mut, null_mut};
|
||||||
|
|
||||||
|
@ -1,4 +1,4 @@
|
|||||||
use super::{context::Context, proc::Proc};
|
use super::{context::Context, process::Process};
|
||||||
use crate::arch::riscv::asm::r_tp;
|
use crate::arch::riscv::asm::r_tp;
|
||||||
use core::ptr::{addr_of_mut, null_mut};
|
use core::ptr::{addr_of_mut, null_mut};
|
||||||
|
|
||||||
@ -8,7 +8,7 @@ pub static mut CPUS: [Cpu; crate::NCPU] = [Cpu::new(); crate::NCPU];
|
|||||||
#[repr(C)]
|
#[repr(C)]
|
||||||
#[derive(Copy, Clone)]
|
#[derive(Copy, Clone)]
|
||||||
pub struct Cpu {
|
pub struct Cpu {
|
||||||
pub proc: *mut Proc,
|
pub proc: *mut Process,
|
||||||
/// swtch() here to enter scheduler()
|
/// swtch() here to enter scheduler()
|
||||||
pub context: Context,
|
pub context: Context,
|
||||||
/// Depth of push_off() nesting.
|
/// Depth of push_off() nesting.
|
||||||
|
@ -1,5 +1,4 @@
|
|||||||
pub mod context;
|
pub mod context;
|
||||||
pub mod cpu;
|
pub mod cpu;
|
||||||
#[allow(clippy::module_inception)]
|
pub mod process;
|
||||||
pub mod proc;
|
|
||||||
pub mod trapframe;
|
pub mod trapframe;
|
||||||
|
@ -14,8 +14,8 @@ use core::{
|
|||||||
};
|
};
|
||||||
|
|
||||||
extern "C" {
|
extern "C" {
|
||||||
pub static mut proc: [Proc; crate::NPROC];
|
pub static mut proc: [Process; crate::NPROC];
|
||||||
pub static mut initproc: *mut Proc;
|
pub static mut initproc: *mut Process;
|
||||||
pub static mut nextpid: i32;
|
pub static mut nextpid: i32;
|
||||||
pub static mut pid_lock: Spinlock;
|
pub static mut pid_lock: Spinlock;
|
||||||
/// Helps ensure that wakeups of wait()ing
|
/// Helps ensure that wakeups of wait()ing
|
||||||
@ -34,11 +34,11 @@ extern "C" {
|
|||||||
pub fn wait(addr: u64) -> i32;
|
pub fn wait(addr: u64) -> i32;
|
||||||
pub fn procdump();
|
pub fn procdump();
|
||||||
pub fn proc_mapstacks(kpgtbl: Pagetable);
|
pub fn proc_mapstacks(kpgtbl: Pagetable);
|
||||||
pub fn proc_pagetable(p: *mut Proc) -> Pagetable;
|
pub fn proc_pagetable(p: *mut Process) -> Pagetable;
|
||||||
pub fn proc_freepagetable(pagetable: Pagetable, sz: u64);
|
pub fn proc_freepagetable(pagetable: Pagetable, sz: u64);
|
||||||
pub fn wakeup(chan: *const c_void);
|
pub fn wakeup(chan: *const c_void);
|
||||||
pub fn allocproc() -> *mut Proc;
|
pub fn allocproc() -> *mut Process;
|
||||||
// pub fn freeproc(p: *mut Proc);
|
// pub fn freeproc(p: *mut Process);
|
||||||
pub fn uvmalloc(pagetable: Pagetable, oldsz: u64, newsz: u64, xperm: i32) -> u64;
|
pub fn uvmalloc(pagetable: Pagetable, oldsz: u64, newsz: u64, xperm: i32) -> u64;
|
||||||
pub fn uvmdealloc(pagetable: Pagetable, oldsz: u64, newsz: u64) -> u64;
|
pub fn uvmdealloc(pagetable: Pagetable, oldsz: u64, newsz: u64) -> u64;
|
||||||
// pub fn sched();
|
// pub fn sched();
|
||||||
@ -50,7 +50,7 @@ pub static NEXT_PID: AtomicI32 = AtomicI32::new(1);
|
|||||||
|
|
||||||
#[repr(C)]
|
#[repr(C)]
|
||||||
#[derive(PartialEq, Default)]
|
#[derive(PartialEq, Default)]
|
||||||
pub enum ProcState {
|
pub enum ProcessState {
|
||||||
#[default]
|
#[default]
|
||||||
Unused,
|
Unused,
|
||||||
Used,
|
Used,
|
||||||
@ -62,12 +62,12 @@ pub enum ProcState {
|
|||||||
|
|
||||||
/// Per-process state.
|
/// Per-process state.
|
||||||
#[repr(C)]
|
#[repr(C)]
|
||||||
pub struct Proc {
|
pub struct Process {
|
||||||
pub lock: Spinlock,
|
pub lock: Spinlock,
|
||||||
|
|
||||||
// p->lock must be held when using these:
|
// p->lock must be held when using these:
|
||||||
/// Process state
|
/// Process state
|
||||||
pub state: ProcState,
|
pub state: ProcessState,
|
||||||
/// If non-zero, sleeping on chan
|
/// If non-zero, sleeping on chan
|
||||||
pub chan: *mut c_void,
|
pub chan: *mut c_void,
|
||||||
/// If non-zero, have been killed
|
/// If non-zero, have been killed
|
||||||
@ -79,7 +79,7 @@ pub struct Proc {
|
|||||||
|
|
||||||
// wait_lock msut be held when using this:
|
// wait_lock msut be held when using this:
|
||||||
/// Parent process
|
/// Parent process
|
||||||
pub parent: *mut Proc,
|
pub parent: *mut Process,
|
||||||
|
|
||||||
// These are private to the process, so p->lock need not be held.
|
// These are private to the process, so p->lock need not be held.
|
||||||
/// Virtual address of kernel stack
|
/// Virtual address of kernel stack
|
||||||
@ -99,11 +99,11 @@ pub struct Proc {
|
|||||||
/// Process name (debugging)
|
/// Process name (debugging)
|
||||||
pub name: [c_char; 16],
|
pub name: [c_char; 16],
|
||||||
}
|
}
|
||||||
impl Proc {
|
impl Process {
|
||||||
pub const fn new() -> Proc {
|
pub const fn new() -> Process {
|
||||||
Proc {
|
Process {
|
||||||
lock: Spinlock::new(),
|
lock: Spinlock::new(),
|
||||||
state: ProcState::Unused,
|
state: ProcessState::Unused,
|
||||||
chan: null_mut(),
|
chan: null_mut(),
|
||||||
killed: 0,
|
killed: 0,
|
||||||
xstate: 0,
|
xstate: 0,
|
||||||
@ -119,7 +119,7 @@ impl Proc {
|
|||||||
name: [0x00; 16],
|
name: [0x00; 16],
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
pub fn current() -> Option<&'static mut Proc> {
|
pub fn current() -> Option<&'static mut Process> {
|
||||||
let _ = crate::trap::InterruptBlocker::new();
|
let _ = crate::trap::InterruptBlocker::new();
|
||||||
let p = Cpu::current().proc;
|
let p = Cpu::current().proc;
|
||||||
if p.is_null() {
|
if p.is_null() {
|
||||||
@ -147,7 +147,7 @@ impl Proc {
|
|||||||
self.chan = null_mut();
|
self.chan = null_mut();
|
||||||
self.killed = 0;
|
self.killed = 0;
|
||||||
self.xstate = 0;
|
self.xstate = 0;
|
||||||
self.state = ProcState::Unused;
|
self.state = ProcessState::Unused;
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Kill the process with the given pid.
|
/// Kill the process with the given pid.
|
||||||
@ -157,15 +157,15 @@ impl Proc {
|
|||||||
pub unsafe fn kill(pid: i32) -> bool {
|
pub unsafe fn kill(pid: i32) -> bool {
|
||||||
for p in &mut proc {
|
for p in &mut proc {
|
||||||
let _guard = p.lock.lock();
|
let _guard = p.lock.lock();
|
||||||
|
|
||||||
if p.pid == pid {
|
if p.pid == pid {
|
||||||
p.killed = 1;
|
p.killed = 1;
|
||||||
|
|
||||||
if p.state == ProcState::Sleeping {
|
if p.state == ProcessState::Sleeping {
|
||||||
// Wake process from sleep().
|
// Wake process from sleep().
|
||||||
p.state = ProcState::Runnable;
|
p.state = ProcessState::Runnable;
|
||||||
}
|
}
|
||||||
|
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -188,9 +188,9 @@ impl Proc {
|
|||||||
|
|
||||||
/// Return the current struct proc *, or zero if none.
|
/// Return the current struct proc *, or zero if none.
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub extern "C" fn myproc() -> *mut Proc {
|
pub extern "C" fn myproc() -> *mut Process {
|
||||||
if let Some(p) = Proc::current() {
|
if let Some(p) = Process::current() {
|
||||||
p as *mut Proc
|
p as *mut Process
|
||||||
} else {
|
} else {
|
||||||
null_mut()
|
null_mut()
|
||||||
}
|
}
|
||||||
@ -204,15 +204,15 @@ pub extern "C" fn allocpid() -> i32 {
|
|||||||
/// Free a proc structure and the data hanging from it, including user pages.
|
/// Free a proc structure and the data hanging from it, including user pages.
|
||||||
/// p->lock must be held.
|
/// p->lock must be held.
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn freeproc(p: *mut Proc) {
|
pub unsafe extern "C" fn freeproc(p: *mut Process) {
|
||||||
(*p).free();
|
(*p).free();
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Pass p's abandoned children to init.
|
/// Pass p's abandoned children to init.
|
||||||
/// Caller must hold wait_lock.
|
/// Caller must hold wait_lock.
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn reparent(p: *mut Proc) {
|
pub unsafe extern "C" fn reparent(p: *mut Process) {
|
||||||
for pp in proc.iter_mut().map(|p: &mut Proc| addr_of_mut!(*p)) {
|
for pp in proc.iter_mut().map(|p: &mut Process| addr_of_mut!(*p)) {
|
||||||
if (*pp).parent == p {
|
if (*pp).parent == p {
|
||||||
(*pp).parent = initproc;
|
(*pp).parent = initproc;
|
||||||
wakeup(initproc.cast());
|
wakeup(initproc.cast());
|
||||||
@ -223,7 +223,7 @@ pub unsafe extern "C" fn reparent(p: *mut Proc) {
|
|||||||
/// Grow or shrink user memory by n bytes.
|
/// Grow or shrink user memory by n bytes.
|
||||||
/// Return 0 on success, -1 on failure.
|
/// Return 0 on success, -1 on failure.
|
||||||
pub unsafe fn growproc(n: i32) -> i32 {
|
pub unsafe fn growproc(n: i32) -> i32 {
|
||||||
let p = Proc::current().unwrap();
|
let p = Process::current().unwrap();
|
||||||
let mut sz = p.sz;
|
let mut sz = p.sz;
|
||||||
|
|
||||||
if n > 0 {
|
if n > 0 {
|
||||||
@ -240,9 +240,9 @@ pub unsafe fn growproc(n: i32) -> i32 {
|
|||||||
|
|
||||||
/// Give up the CPU for one scheduling round.
|
/// Give up the CPU for one scheduling round.
|
||||||
pub unsafe fn r#yield() {
|
pub unsafe fn r#yield() {
|
||||||
let p = Proc::current().unwrap();
|
let p = Process::current().unwrap();
|
||||||
let _guard = p.lock.lock();
|
let _guard = p.lock.lock();
|
||||||
p.state = ProcState::Runnable;
|
p.state = ProcessState::Runnable;
|
||||||
sched();
|
sched();
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -255,12 +255,12 @@ pub unsafe fn r#yield() {
|
|||||||
/// there's no process.
|
/// there's no process.
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn sched() {
|
pub unsafe extern "C" fn sched() {
|
||||||
let p = Proc::current().unwrap();
|
let p = Process::current().unwrap();
|
||||||
let cpu = Cpu::current();
|
let cpu = Cpu::current();
|
||||||
|
|
||||||
if cpu.interrupt_disable_layers != 1 {
|
if cpu.interrupt_disable_layers != 1 {
|
||||||
panic!("sched locks");
|
panic!("sched locks");
|
||||||
} else if p.state == ProcState::Running {
|
} else if p.state == ProcessState::Running {
|
||||||
panic!("sched running");
|
panic!("sched running");
|
||||||
} else if intr_get() > 0 {
|
} else if intr_get() > 0 {
|
||||||
panic!("sched interruptible");
|
panic!("sched interruptible");
|
||||||
@ -283,12 +283,12 @@ pub unsafe extern "C" fn sleep_lock(chan: *mut c_void, lock: *mut Spinlock) {
|
|||||||
|
|
||||||
/// Sleep until `wakeup(chan)` is called somewhere else.
|
/// Sleep until `wakeup(chan)` is called somewhere else.
|
||||||
pub unsafe fn sleep(chan: *mut c_void) {
|
pub unsafe fn sleep(chan: *mut c_void) {
|
||||||
let p = Proc::current().unwrap();
|
let p = Process::current().unwrap();
|
||||||
let _guard = p.lock.lock();
|
let _guard = p.lock.lock();
|
||||||
|
|
||||||
// Go to sleep.
|
// Go to sleep.
|
||||||
p.chan = chan;
|
p.chan = chan;
|
||||||
p.state = ProcState::Sleeping;
|
p.state = ProcessState::Sleeping;
|
||||||
|
|
||||||
sched();
|
sched();
|
||||||
|
|
||||||
@ -301,7 +301,7 @@ pub unsafe fn sleep(chan: *mut c_void) {
|
|||||||
/// to user space (see usertrap() in trap.c).
|
/// to user space (see usertrap() in trap.c).
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn kill(pid: i32) -> i32 {
|
pub unsafe extern "C" fn kill(pid: i32) -> i32 {
|
||||||
if Proc::kill(pid) {
|
if Process::kill(pid) {
|
||||||
1
|
1
|
||||||
} else {
|
} else {
|
||||||
0
|
0
|
||||||
@ -309,12 +309,12 @@ pub unsafe extern "C" fn kill(pid: i32) -> i32 {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn setkilled(p: *mut Proc) {
|
pub unsafe extern "C" fn setkilled(p: *mut Process) {
|
||||||
(*p).set_killed(true);
|
(*p).set_killed(true);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn killed(p: *mut Proc) -> i32 {
|
pub unsafe extern "C" fn killed(p: *mut Process) -> i32 {
|
||||||
if (*p).is_killed() {
|
if (*p).is_killed() {
|
||||||
1
|
1
|
||||||
} else {
|
} else {
|
@ -1,5 +1,5 @@
|
|||||||
use super::LockStrategy;
|
use super::LockStrategy;
|
||||||
use crate::proc::proc::{sched, sleep, wakeup, Proc, ProcState};
|
use crate::proc::process::{sched, sleep, wakeup, Process, ProcessState};
|
||||||
use core::{
|
use core::{
|
||||||
cell::UnsafeCell,
|
cell::UnsafeCell,
|
||||||
ops::Drop,
|
ops::Drop,
|
||||||
@ -83,14 +83,14 @@ impl<'l> LockGuard<'l> {
|
|||||||
/// Sleep until `wakeup(chan)` is called somewhere
|
/// Sleep until `wakeup(chan)` is called somewhere
|
||||||
/// else, yielding access to the lock until then.
|
/// else, yielding access to the lock until then.
|
||||||
pub unsafe fn sleep(&self, chan: *mut core::ffi::c_void) {
|
pub unsafe fn sleep(&self, chan: *mut core::ffi::c_void) {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
let _guard = proc.lock.lock();
|
let _guard = proc.lock.lock();
|
||||||
let strategy = self.lock.lock_strategy();
|
let strategy = self.lock.lock_strategy();
|
||||||
self.lock.unlock();
|
self.lock.unlock();
|
||||||
|
|
||||||
// Put the process to sleep.
|
// Put the process to sleep.
|
||||||
proc.chan = chan;
|
proc.chan = chan;
|
||||||
proc.state = ProcState::Sleeping;
|
proc.state = ProcessState::Sleeping;
|
||||||
sched();
|
sched();
|
||||||
|
|
||||||
// Tidy up and reacquire the lock.
|
// Tidy up and reacquire the lock.
|
||||||
|
@ -1,4 +1,4 @@
|
|||||||
use crate::proc::proc::{sleep, wakeup};
|
use crate::proc::process::{sleep, wakeup};
|
||||||
use core::{
|
use core::{
|
||||||
ffi::c_char,
|
ffi::c_char,
|
||||||
ptr::addr_of,
|
ptr::addr_of,
|
||||||
|
@ -1,5 +1,5 @@
|
|||||||
use crate::{
|
use crate::{
|
||||||
proc::proc::{sched, Proc, ProcState},
|
proc::process::{sched, Process, ProcessState},
|
||||||
trap::{pop_intr_off, push_intr_off},
|
trap::{pop_intr_off, push_intr_off},
|
||||||
};
|
};
|
||||||
use core::{
|
use core::{
|
||||||
@ -46,13 +46,13 @@ pub struct SpinlockGuard<'l> {
|
|||||||
impl<'l> SpinlockGuard<'l> {
|
impl<'l> SpinlockGuard<'l> {
|
||||||
/// Sleep until `wakeup(chan)` is called somewhere else, yielding the lock until then.
|
/// Sleep until `wakeup(chan)` is called somewhere else, yielding the lock until then.
|
||||||
pub unsafe fn sleep(&self, chan: *mut core::ffi::c_void) {
|
pub unsafe fn sleep(&self, chan: *mut core::ffi::c_void) {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
let _guard = proc.lock.lock();
|
let _guard = proc.lock.lock();
|
||||||
self.lock.unlock();
|
self.lock.unlock();
|
||||||
|
|
||||||
// Put the process to sleep.
|
// Put the process to sleep.
|
||||||
proc.chan = chan;
|
proc.chan = chan;
|
||||||
proc.state = ProcState::Sleeping;
|
proc.state = ProcessState::Sleeping;
|
||||||
sched();
|
sched();
|
||||||
|
|
||||||
// Tidy up and reacquire the lock.
|
// Tidy up and reacquire the lock.
|
||||||
|
@ -8,7 +8,7 @@ use crate::{
|
|||||||
},
|
},
|
||||||
mem::virtual_memory::{copyin, copyinstr},
|
mem::virtual_memory::{copyin, copyinstr},
|
||||||
println,
|
println,
|
||||||
proc::proc::{self, Proc},
|
proc::process::{self, Process},
|
||||||
string::strlen,
|
string::strlen,
|
||||||
trap::CLOCK_TICKS,
|
trap::CLOCK_TICKS,
|
||||||
NOFILE,
|
NOFILE,
|
||||||
@ -57,16 +57,16 @@ pub enum Syscall {
|
|||||||
impl Syscall {
|
impl Syscall {
|
||||||
pub unsafe fn call(&self) -> u64 {
|
pub unsafe fn call(&self) -> u64 {
|
||||||
match self {
|
match self {
|
||||||
Syscall::Fork => proc::fork() as u64,
|
Syscall::Fork => process::fork() as u64,
|
||||||
Syscall::Exit => {
|
Syscall::Exit => {
|
||||||
let mut n = 0i32;
|
let mut n = 0i32;
|
||||||
argint(0, addr_of_mut!(n));
|
argint(0, addr_of_mut!(n));
|
||||||
proc::exit(n)
|
process::exit(n)
|
||||||
}
|
}
|
||||||
Syscall::Wait => {
|
Syscall::Wait => {
|
||||||
let mut p = 0u64;
|
let mut p = 0u64;
|
||||||
argaddr(0, addr_of_mut!(p));
|
argaddr(0, addr_of_mut!(p));
|
||||||
proc::wait(p) as u64
|
process::wait(p) as u64
|
||||||
}
|
}
|
||||||
Syscall::Pipe => sys_pipe(),
|
Syscall::Pipe => sys_pipe(),
|
||||||
Syscall::Read => {
|
Syscall::Read => {
|
||||||
@ -85,7 +85,7 @@ impl Syscall {
|
|||||||
Syscall::Kill => {
|
Syscall::Kill => {
|
||||||
let mut pid = 0i32;
|
let mut pid = 0i32;
|
||||||
argint(0, addr_of_mut!(pid));
|
argint(0, addr_of_mut!(pid));
|
||||||
Proc::kill(pid) as u64
|
Process::kill(pid) as u64
|
||||||
}
|
}
|
||||||
Syscall::Exec => sys_exec(),
|
Syscall::Exec => sys_exec(),
|
||||||
Syscall::Fstat => {
|
Syscall::Fstat => {
|
||||||
@ -102,7 +102,7 @@ impl Syscall {
|
|||||||
}
|
}
|
||||||
Syscall::Chdir => {
|
Syscall::Chdir => {
|
||||||
let mut path = [0u8; crate::MAXPATH];
|
let mut path = [0u8; crate::MAXPATH];
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
let _operation = LogOperation::new();
|
let _operation = LogOperation::new();
|
||||||
|
|
||||||
@ -138,13 +138,13 @@ impl Syscall {
|
|||||||
file::filedup(file);
|
file::filedup(file);
|
||||||
file_descriptor as u64
|
file_descriptor as u64
|
||||||
}
|
}
|
||||||
Syscall::Getpid => Proc::current().unwrap().pid as u64,
|
Syscall::Getpid => Process::current().unwrap().pid as u64,
|
||||||
Syscall::Sbrk => {
|
Syscall::Sbrk => {
|
||||||
let mut n = 0i32;
|
let mut n = 0i32;
|
||||||
argint(0, addr_of_mut!(n));
|
argint(0, addr_of_mut!(n));
|
||||||
let addr = Proc::current().unwrap().sz;
|
let addr = Process::current().unwrap().sz;
|
||||||
|
|
||||||
if proc::growproc(n) < 0 {
|
if process::growproc(n) < 0 {
|
||||||
-1i64 as u64
|
-1i64 as u64
|
||||||
} else {
|
} else {
|
||||||
addr
|
addr
|
||||||
@ -157,7 +157,7 @@ impl Syscall {
|
|||||||
let mut ticks = CLOCK_TICKS.lock_spinning();
|
let mut ticks = CLOCK_TICKS.lock_spinning();
|
||||||
|
|
||||||
while *ticks < *ticks + n as usize {
|
while *ticks < *ticks + n as usize {
|
||||||
if Proc::current().unwrap().is_killed() {
|
if Process::current().unwrap().is_killed() {
|
||||||
return -1i64 as u64;
|
return -1i64 as u64;
|
||||||
}
|
}
|
||||||
// Sleep until the value changes.
|
// Sleep until the value changes.
|
||||||
@ -191,7 +191,7 @@ impl Syscall {
|
|||||||
let mut file: *mut File = null_mut();
|
let mut file: *mut File = null_mut();
|
||||||
|
|
||||||
if argfd(0, addr_of_mut!(file_descriptor), addr_of_mut!(file)) >= 0 {
|
if argfd(0, addr_of_mut!(file_descriptor), addr_of_mut!(file)) >= 0 {
|
||||||
Proc::current().unwrap().ofile[file_descriptor as usize] = null_mut();
|
Process::current().unwrap().ofile[file_descriptor as usize] = null_mut();
|
||||||
file::fileclose(file);
|
file::fileclose(file);
|
||||||
0
|
0
|
||||||
} else {
|
} else {
|
||||||
@ -269,7 +269,7 @@ impl From<Syscall> for usize {
|
|||||||
/// Fetch the u64 at addr from the current process.
|
/// Fetch the u64 at addr from the current process.
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn fetchaddr(addr: u64, ip: *mut u64) -> i32 {
|
pub unsafe extern "C" fn fetchaddr(addr: u64, ip: *mut u64) -> i32 {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
// Both tests needed, in case of overflow.
|
// Both tests needed, in case of overflow.
|
||||||
if addr >= proc.sz
|
if addr >= proc.sz
|
||||||
@ -292,7 +292,7 @@ pub unsafe extern "C" fn fetchaddr(addr: u64, ip: *mut u64) -> i32 {
|
|||||||
/// Returns length of string, not including null, or -1 for error.
|
/// Returns length of string, not including null, or -1 for error.
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn fetchstr(addr: u64, buf: *mut u8, max: i32) -> i32 {
|
pub unsafe extern "C" fn fetchstr(addr: u64, buf: *mut u8, max: i32) -> i32 {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
if copyinstr(proc.pagetable, buf, addr, max as u64) < 0 {
|
if copyinstr(proc.pagetable, buf, addr, max as u64) < 0 {
|
||||||
-1
|
-1
|
||||||
@ -304,7 +304,7 @@ pub unsafe extern "C" fn fetchstr(addr: u64, buf: *mut u8, max: i32) -> i32 {
|
|||||||
/// Allocate a file descriptor for the given file.
|
/// Allocate a file descriptor for the given file.
|
||||||
/// Takes over file reference from caller on success.
|
/// Takes over file reference from caller on success.
|
||||||
unsafe fn fdalloc(file: *mut File) -> Result<usize, ()> {
|
unsafe fn fdalloc(file: *mut File) -> Result<usize, ()> {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
for file_descriptor in 0..crate::NOFILE {
|
for file_descriptor in 0..crate::NOFILE {
|
||||||
if proc.ofile[file_descriptor].is_null() {
|
if proc.ofile[file_descriptor].is_null() {
|
||||||
@ -316,7 +316,7 @@ unsafe fn fdalloc(file: *mut File) -> Result<usize, ()> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
unsafe fn argraw(argument_index: usize) -> u64 {
|
unsafe fn argraw(argument_index: usize) -> u64 {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
match argument_index {
|
match argument_index {
|
||||||
0 => (*proc.trapframe).a0,
|
0 => (*proc.trapframe).a0,
|
||||||
@ -357,7 +357,7 @@ pub unsafe extern "C" fn argfd(
|
|||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
|
|
||||||
let file: *mut File = Proc::current().unwrap().ofile[file_descriptor];
|
let file: *mut File = Process::current().unwrap().ofile[file_descriptor];
|
||||||
if file.is_null() {
|
if file.is_null() {
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
@ -383,7 +383,7 @@ pub unsafe extern "C" fn argstr(n: i32, buf: *mut u8, max: i32) -> i32 {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub unsafe fn syscall() {
|
pub unsafe fn syscall() {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
let num = (*proc.trapframe).a7;
|
let num = (*proc.trapframe).a7;
|
||||||
|
|
||||||
|
@ -3,7 +3,7 @@ use crate::{
|
|||||||
println,
|
println,
|
||||||
proc::{
|
proc::{
|
||||||
cpu::Cpu,
|
cpu::Cpu,
|
||||||
proc::{exit, r#yield, wakeup, Proc, ProcState},
|
process::{exit, r#yield, wakeup, Process, ProcessState},
|
||||||
},
|
},
|
||||||
sync::mutex::Mutex,
|
sync::mutex::Mutex,
|
||||||
syscall::syscall,
|
syscall::syscall,
|
||||||
@ -127,7 +127,7 @@ impl !Send for InterruptBlocker {}
|
|||||||
/// Return to user space
|
/// Return to user space
|
||||||
#[no_mangle]
|
#[no_mangle]
|
||||||
pub unsafe extern "C" fn usertrapret() {
|
pub unsafe extern "C" fn usertrapret() {
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
// We're about to switch the destination of traps from
|
// We're about to switch the destination of traps from
|
||||||
// kerneltrap() to usertrap(), so turn off interrupts until
|
// kerneltrap() to usertrap(), so turn off interrupts until
|
||||||
@ -196,8 +196,8 @@ pub unsafe extern "C" fn kerneltrap() {
|
|||||||
println!("scause {}\nsepc={} stval={}", scause, r_sepc(), r_stval());
|
println!("scause {}\nsepc={} stval={}", scause, r_sepc(), r_stval());
|
||||||
panic!("kerneltrap");
|
panic!("kerneltrap");
|
||||||
} else if which_dev == 2
|
} else if which_dev == 2
|
||||||
&& Proc::current().is_some()
|
&& Process::current().is_some()
|
||||||
&& Proc::current().unwrap().state == ProcState::Running
|
&& Process::current().unwrap().state == ProcessState::Running
|
||||||
{
|
{
|
||||||
// Give up the CPU if this is a timer interrupt.
|
// Give up the CPU if this is a timer interrupt.
|
||||||
r#yield();
|
r#yield();
|
||||||
@ -222,14 +222,14 @@ pub unsafe extern "C" fn usertrap() {
|
|||||||
// since we're now in the kernel.
|
// since we're now in the kernel.
|
||||||
w_stvec(kernelvec as usize as u64);
|
w_stvec(kernelvec as usize as u64);
|
||||||
|
|
||||||
let proc = Proc::current().unwrap();
|
let proc = Process::current().unwrap();
|
||||||
|
|
||||||
// Save user program counter.
|
// Save user program counter.
|
||||||
(*proc.trapframe).epc = r_sepc();
|
(*proc.trapframe).epc = r_sepc();
|
||||||
|
|
||||||
if r_scause() == 8 {
|
if r_scause() == 8 {
|
||||||
// System call
|
// System call
|
||||||
|
|
||||||
if proc.is_killed() {
|
if proc.is_killed() {
|
||||||
exit(-1);
|
exit(-1);
|
||||||
}
|
}
|
||||||
|
Loading…
x
Reference in New Issue
Block a user